Difference between revisions of "SJ16049"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] == * common-name: ** isopenicillin n * smiles: ** cc1(c)(s[ch]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * common-name: ** 18-hydroxyoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPENICILLIN-N ISOPENICILLIN-N] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
 
* common-name:
 
* common-name:
** isopenicillin n
+
** 18-hydroxyoleoyl-coa
 
* smiles:
 
* smiles:
** cc1(c)(s[ch]2(c(c(=o)n(c(c(=o)[o-])1)2)nc(=o)cccc([n+])c(=o)[o-]))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mifyhuacuwqukt-gtqwgbsqsa-m
+
** mqacsuxwiyyzak-utnxwdcosa-j
 
* molecular-weight:
 
* molecular-weight:
** 358.388
+
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16117]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.21.3.1-RXN]]
+
* [[RXN-16402]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isopenicillin n}}
+
{{#set: common-name=18-hydroxyoleoyl-coa}}
{{#set: inchi-key=inchikey=mifyhuacuwqukt-gtqwgbsqsa-m}}
+
{{#set: inchi-key=inchikey=mqacsuxwiyyzak-utnxwdcosa-j}}
{{#set: molecular-weight=358.388}}
+
{{#set: molecular-weight=1043.952}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-17370

  • common-name:
    • 18-hydroxyoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mqacsuxwiyyzak-utnxwdcosa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality