Difference between revisions of "SJ16080"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == * common-name: ** itaconyl-coa * smiles: ** c=c(cc(sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] == * common-name: ** a 5...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5MeAminoMe-2-ThioU tRNA-Containing-5MeAminoMe-2-ThioU] ==
 
* common-name:
 
* common-name:
** itaconyl-coa
+
** a 5-methylaminomethyl-2-thiouridine34 in trna
* smiles:
 
** c=c(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
** nfvgylgssjprkw-citakdkdsa-i
 
* molecular-weight:
 
** 874.579
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8988]]
+
* [[RXN0-5144]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=itaconyl-coa}}
+
{{#set: common-name=a 5-methylaminomethyl-2-thiouridine34 in trna}}
{{#set: inchi-key=inchikey=nfvgylgssjprkw-citakdkdsa-i}}
 
{{#set: molecular-weight=874.579}}
 

Revision as of 09:24, 27 August 2019

Metabolite tRNA-Containing-5MeAminoMe-2-ThioU

  • common-name:
    • a 5-methylaminomethyl-2-thiouridine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality