Difference between revisions of "SJ16087"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLY-tRNAs Charged-GLY-tRNAs] == * common-name: ** a glycyl-[trnagly] == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLY-tRNAs Charged-GLY-tRNAs] ==
 
* common-name:
 
* common-name:
** 2,3-dimethyl-6-phytyl-1,4-benzoquinol
+
** a glycyl-[trnagly]
* smiles:
 
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
 
* inchi-key:
 
** sufzkubnovdjrr-wgeodtkdsa-n
 
* molecular-weight:
 
** 416.686
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2542]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}}
+
{{#set: common-name=a glycyl-[trnagly]}}
{{#set: inchi-key=inchikey=sufzkubnovdjrr-wgeodtkdsa-n}}
 
{{#set: molecular-weight=416.686}}
 

Revision as of 14:20, 26 August 2019

Metabolite Charged-GLY-tRNAs

  • common-name:
    • a glycyl-[trnagly]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a glycyl-[trnagly" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.