Difference between revisions of "SJ16096"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-396 CPD-396] == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribonucleoside-Triphosphates Ribonucleoside-Triphosphates] == * common-name: ** a ribonucleosid...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-396 CPD-396] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribonucleoside-Triphosphates Ribonucleoside-Triphosphates] ==
 
* common-name:
 
* common-name:
** 1-methylnicotinamide
+
** a ribonucleoside triphosphate
* smiles:
 
** c[n+]1(=cc=cc(=c1)c(=o)n)
 
* inchi-key:
 
** ldhmavipbrsvrg-uhfffaoysa-o
 
* molecular-weight:
 
** 137.161
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.17.4.2-RXN]]
 +
* [[RXN0-5021]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-methylnicotinamide}}
+
{{#set: common-name=a ribonucleoside triphosphate}}
{{#set: inchi-key=inchikey=ldhmavipbrsvrg-uhfffaoysa-o}}
 
{{#set: molecular-weight=137.161}}
 

Revision as of 09:24, 27 August 2019

Metabolite Ribonucleoside-Triphosphates

  • common-name:
    • a ribonucleoside triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality