Difference between revisions of "SJ16112"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinones Ubiquinones] == * common-name: ** a ubiquinone == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinones Ubiquinones] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] ==
 
* common-name:
 
* common-name:
** a ubiquinone
+
** kanamycin a
 +
* smiles:
 +
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 +
* inchi-key:
 +
** sbujhosqtjfqjx-noamyhissa-r
 +
* molecular-weight:
 +
** 488.534
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.10.2.2-RXN]]
+
* [[RXN-13167]]
* [[1.5.5.1-RXN]]
+
* [[RXN-15285]]
* [[NADH-DEHYDROG-A-RXN]]
 
* [[RXN-15829]]
 
* [[RXN0-5260]]
 
* [[RXN0-5330]]
 
* [[RXN0-6491]]
 
* [[RXN0-7008]]
 
* [[RXN66-542]]
 
* [[RXN66-550]]
 
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.10.2.2-RXN]]
 
* [[1.5.5.1-RXN]]
 
* [[NADH-DEHYDROG-A-RXN]]
 
* [[RXN-6883]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ubiquinone}}
+
{{#set: common-name=kanamycin a}}
 +
{{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}}
 +
{{#set: molecular-weight=488.534}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-4821

  • common-name:
    • kanamycin a
  • smiles:
    • c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • sbujhosqtjfqjx-noamyhissa-r
  • molecular-weight:
    • 488.534

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality