Difference between revisions of "SJ16112"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinones Ubiquinones] == * common-name: ** a ubiquinone == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] == * common-name: ** kanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4821 CPD-4821] == |
* common-name: | * common-name: | ||
− | ** a | + | ** kanamycin a |
+ | * smiles: | ||
+ | ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+])) | ||
+ | * inchi-key: | ||
+ | ** sbujhosqtjfqjx-noamyhissa-r | ||
+ | * molecular-weight: | ||
+ | ** 488.534 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13167]] |
− | + | * [[RXN-15285]] | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=a | + | {{#set: common-name=kanamycin a}} |
+ | {{#set: inchi-key=inchikey=sbujhosqtjfqjx-noamyhissa-r}} | ||
+ | {{#set: molecular-weight=488.534}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-4821
- common-name:
- kanamycin a
- smiles:
- c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- sbujhosqtjfqjx-noamyhissa-r
- molecular-weight:
- 488.534