Difference between revisions of "SJ16129"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * common-name: ** 3-hydroxy-5-methylhex-4-enoyl-coa * smiles: ** cc(c)=...")
(Created page with "Category:gene == Gene SJ18017 == * transcription-direction: ** positive * right-end-position: ** 199027 * left-end-position: ** 169942 * centisome-position: ** 25.888863...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Gene SJ18017 ==
* common-name:
+
* transcription-direction:
** 3-hydroxy-5-methylhex-4-enoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 199027
* inchi-key:
+
* left-end-position:
** olzynlskrkfujc-fpviqycmsa-j
+
** 169942
* molecular-weight:
+
* centisome-position:
** 889.657
+
** 25.888863   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[RXN-11919]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
{{#set: common-name=3-hydroxy-5-methylhex-4-enoyl-coa}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=olzynlskrkfujc-fpviqycmsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=889.657}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=199027}}
 +
{{#set: left-end-position=169942}}
 +
{{#set: centisome-position=25.888863    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ18017

  • transcription-direction:
    • positive
  • right-end-position:
    • 199027
  • left-end-position:
    • 169942
  • centisome-position:
    • 25.888863

Organism(s) associated with this gene

Reaction(s) associated