Difference between revisions of "SJ16180"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00250 == * transcription-direction: ** negative * right-end-position: ** 89721 * left-end-position: ** 65069 * centisome-position: ** 38.22529...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * common-name: ** (r)-s-lactoylglutathione * sm...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00250 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
* transcription-direction:
+
* common-name:
** negative
+
** (r)-s-lactoylglutathione
* right-end-position:
+
* smiles:
** 89721
+
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 65069
+
** vdydcvuwiliyqf-csmhccousa-m
* centisome-position:
+
* molecular-weight:
** 38.22529   
+
** 378.376
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[GLYOXI-RXN]]
== Reaction(s) associated ==
+
* [[GLYOXII-RXN]]
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[GLYOXI-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=(r)-s-lactoylglutathione}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=378.376}}
* [[GLUTAMATE-DEG1-PWY]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
* [[ALACAT2-PWY]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5022]]
 
** '''3''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7126]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-6728]]
 
** '''11''' reactions found over '''19''' reactions in the full pathway
 
* [[P162-PWY]]
 
** '''7''' reactions found over '''11''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=89721}}
 
{{#set: left-end-position=65069}}
 
{{#set: centisome-position=38.22529    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=6}}
 

Revision as of 09:25, 27 August 2019

Metabolite S-LACTOYL-GLUTATHIONE

  • common-name:
    • (r)-s-lactoylglutathione
  • smiles:
    • cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • vdydcvuwiliyqf-csmhccousa-m
  • molecular-weight:
    • 378.376

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality