Difference between revisions of "SJ16180"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00250 == * transcription-direction: ** negative * right-end-position: ** 89721 * left-end-position: ** 65069 * centisome-position: ** 38.22529...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * common-name: ** (r)-s-lactoylglutathione * sm...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == |
− | * | + | * common-name: |
− | ** | + | ** (r)-s-lactoylglutathione |
− | + | * smiles: | |
− | + | ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | |
− | * | + | * inchi-key: |
− | ** | + | ** vdydcvuwiliyqf-csmhccousa-m |
− | + | * molecular-weight: | |
− | + | ** 378.376 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[GLYOXI-RXN]] | |
− | == | + | * [[GLYOXII-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[GLYOXI-RXN]] |
− | ** | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=(r)-s-lactoylglutathione}} |
− | ** | + | {{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}} |
− | == | + | {{#set: molecular-weight=378.376}} |
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite S-LACTOYL-GLUTATHIONE
- common-name:
- (r)-s-lactoylglutathione
- smiles:
- cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- vdydcvuwiliyqf-csmhccousa-m
- molecular-weight:
- 378.376