Difference between revisions of "SJ16242"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIOCYSTEINE THIOCYSTEINE] == * common-name: ** thiocysteine * smiles: ** c(ss)c(c([o-])=o)[n+]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIOCYSTEINE THIOCYSTEINE] ==
 
* common-name:
 
* common-name:
** β-d-galactose
+
** thiocysteine
 
* smiles:
 
* smiles:
** c(o)c1(oc(o)c(o)c(o)c(o)1)
+
** c(ss)c(c([o-])=o)[n+]
 
* inchi-key:
 
* inchi-key:
** wqzgkkkjijffok-fprjbgldsa-n
+
** xbkonscrebsmcs-reohclbhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 153.214
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALDOSE1EPIM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[CYSTHIOCYS-RXN]]
* [[BETAGALACTOSID-RXN]]
+
* [[RXN-15128]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-galactose}}
+
{{#set: common-name=thiocysteine}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-fprjbgldsa-n}}
+
{{#set: inchi-key=inchikey=xbkonscrebsmcs-reohclbhsa-n}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=153.214}}

Revision as of 14:19, 26 August 2019

Metabolite THIOCYSTEINE

  • common-name:
    • thiocysteine
  • smiles:
    • c(ss)c(c([o-])=o)[n+]
  • inchi-key:
    • xbkonscrebsmcs-reohclbhsa-n
  • molecular-weight:
    • 153.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality