Difference between revisions of "SJ16242"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * common-name: ** 3-oxo-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(=o...")
(Created page with "Category:gene == Gene SJ16242 == * transcription-direction: ** negative * right-end-position: ** 401123 * left-end-position: ** 396877 * centisome-position: ** 57.548435...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Gene SJ16242 ==
* common-name:
+
* transcription-direction:
** 3-oxo-(5z)-dodecenoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 401123
* inchi-key:
+
* left-end-position:
** vklhslowdwgvgp-cggpsvllsa-j
+
** 396877
* molecular-weight:
+
* centisome-position:
** 957.775
+
** 57.548435   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17799]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17798]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=3-oxo-(5z)-dodecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=vklhslowdwgvgp-cggpsvllsa-j}}
+
** Category: [[orthology]]
{{#set: molecular-weight=957.775}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=401123}}
 +
{{#set: left-end-position=396877}}
 +
{{#set: centisome-position=57.548435    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ16242

  • transcription-direction:
    • negative
  • right-end-position:
    • 401123
  • left-end-position:
    • 396877
  • centisome-position:
    • 57.548435

Organism(s) associated with this gene

Reaction(s) associated