Difference between revisions of "SJ16285"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * common-name: ** gibberellin a1 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] ==
 
* common-name:
 
* common-name:
** damp
+
** gibberellin a1
 
* smiles:
 
* smiles:
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
+
** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** khwchtkseggwex-rrkcrqdmsa-l
+
** jljlrlwoemwyqk-sntjwbgvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 329.208
+
** 347.387
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDAM]]
+
* [[RXN-115]]
* [[DAMPH]]
 
* [[DEOXYADENYLATE-KINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAMPH]]
 
* [[RXN-14195]]
 
* [[RXN-14215]]
 
* [[RXN0-384]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=damp}}
+
{{#set: common-name=gibberellin a1}}
{{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}}
+
{{#set: inchi-key=inchikey=jljlrlwoemwyqk-sntjwbgvsa-m}}
{{#set: molecular-weight=329.208}}
+
{{#set: molecular-weight=347.387}}

Revision as of 14:20, 26 August 2019

Metabolite CPD1F-139

  • common-name:
    • gibberellin a1
  • smiles:
    • c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(ccc(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
  • inchi-key:
    • jljlrlwoemwyqk-sntjwbgvsa-m
  • molecular-weight:
    • 347.387

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality