Difference between revisions of "SJ16290"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * common-name: ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smil...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * common-name: ** hypoxanthine * smiles: ** c1(nc2(=c(n=1)n=cnc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] ==
 
* common-name:
 
* common-name:
** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** hypoxanthine
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c1(nc2(=c(n=1)n=cnc(=o)2))
 
* inchi-key:
 
* inchi-key:
** mmzjvinjfsrjok-cynjbpnesa-j
+
** fdgqstzjbfjubt-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 136.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DEOXYINOPHOSPHOR-RXN]]
 +
* [[HPRT]]
 +
* [[HYPOXANPRIBOSYLTRAN-RXN]]
 +
* [[INOPHOSPHOR-RXN]]
 +
* [[RXN-7682]]
 +
* [[XANDH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16130]]
+
* [[DEOXYINOPHOSPHOR-RXN]]
 +
* [[HPRT]]
 +
* [[INOPHOSPHOR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=hypoxanthine}}
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
+
{{#set: inchi-key=inchikey=fdgqstzjbfjubt-uhfffaoysa-n}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=136.113}}

Revision as of 09:24, 27 August 2019

Metabolite HYPOXANTHINE

  • common-name:
    • hypoxanthine
  • smiles:
    • c1(nc2(=c(n=1)n=cnc(=o)2))
  • inchi-key:
    • fdgqstzjbfjubt-uhfffaoysa-n
  • molecular-weight:
    • 136.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality