Difference between revisions of "SJ16357"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-HYDROXYMETHYLGLUTATHIONE S-HYDROXYMETHYLGLUTATHIONE] == * common-name: ** s-(hydroxymethyl)gl...")
(Created page with "Category:gene == Gene SJ16357 == * transcription-direction: ** negative * right-end-position: ** 151474 * left-end-position: ** 132413 * centisome-position: ** 46.581486...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-HYDROXYMETHYLGLUTATHIONE S-HYDROXYMETHYLGLUTATHIONE] ==
+
== Gene SJ16357 ==
* common-name:
+
* transcription-direction:
** s-(hydroxymethyl)glutathione
+
** negative
* smiles:
+
* right-end-position:
** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
+
** 151474
* inchi-key:
+
* left-end-position:
** piuslwsyoyfrfr-bqbzgakwsa-m
+
** 132413
* molecular-weight:
+
* centisome-position:
** 336.339
+
** 46.581486   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-2962]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN0-276]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[RXN0-276]]
+
* [[2.7.10.1-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=s-(hydroxymethyl)glutathione}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=piuslwsyoyfrfr-bqbzgakwsa-m}}
+
* [[2.7.12.1-RXN]]
{{#set: molecular-weight=336.339}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[2.7.12.2-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-16317]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
</div>
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=151474}}
 +
{{#set: left-end-position=132413}}
 +
{{#set: centisome-position=46.581486    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=6}}

Latest revision as of 11:00, 18 March 2021

Gene SJ16357

  • transcription-direction:
    • negative
  • right-end-position:
    • 151474
  • left-end-position:
    • 132413
  • centisome-position:
    • 46.581486

Organism(s) associated with this gene

Reaction(s) associated