Difference between revisions of "SJ16374"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11855 CPD-11855] == * common-name: ** (r)-4-hydroxy-4-methyl-2-oxoglutarate * smiles: ** cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nucleosides Nucleosides] == * common-name: ** a nucleoside == Reaction(s) known to consume the...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11855 CPD-11855] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Nucleosides Nucleosides] ==
 
* common-name:
 
* common-name:
** (r)-4-hydroxy-4-methyl-2-oxoglutarate
+
** a nucleoside
* smiles:
 
** cc(o)(cc(c(=o)[o-])=o)c([o-])=o
 
* inchi-key:
 
** yrwamsxhybbhfl-zcfiwibfsa-l
 
* molecular-weight:
 
** 174.11
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12074]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12074]]
+
* [[NUCLEOTIDASE-RXN]]
 +
* [[RXN-14473]]
 +
* [[RXN-17947]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-4-hydroxy-4-methyl-2-oxoglutarate}}
+
{{#set: common-name=a nucleoside}}
{{#set: inchi-key=inchikey=yrwamsxhybbhfl-zcfiwibfsa-l}}
 
{{#set: molecular-weight=174.11}}
 

Revision as of 14:20, 26 August 2019

Metabolite Nucleosides

  • common-name:
    • a nucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality