Difference between revisions of "SJ16382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-692 CPD-692] == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-SP-2Fe2S-Complex CD-SP-2Fe2S-Complex] == * common-name: ** a [cysteine desulfurase]-[scaffol...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-692 CPD-692] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-SP-2Fe2S-Complex CD-SP-2Fe2S-Complex] ==
 
* common-name:
 
* common-name:
** (+)-cis-abscisic aldehyde
+
** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex
* smiles:
 
** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
 
* inchi-key:
 
** rikwdzwvhuiuam-kicrzjjpsa-n
 
* molecular-weight:
 
** 248.321
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.2.3.14-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.288-RXN]]
+
* [[RXN-14387]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-cis-abscisic aldehyde}}
+
{{#set: common-name=a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex}}
{{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}}
 
{{#set: molecular-weight=248.321}}
 

Revision as of 14:19, 26 August 2019

Metabolite CD-SP-2Fe2S-Complex

  • common-name:
    • a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.