Difference between revisions of "SJ16425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] == * common-name: ** nigerose * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-BETA-D-GLUCOSYLGLUCOSE 3-BETA-D-GLUCOSYLGLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] ==
 
* common-name:
 
* common-name:
** nigerose
+
** 4-trans-undecenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c2(c(o)c(o)c(o)c(oc1(c(o)c(o)oc(co)c(o)1))o2)
+
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** qigjyvcqydkydw-nsyytrpssa-n
+
** afmmiiqkxqnedn-dupkwvsksa-j
 
* molecular-weight:
 
* molecular-weight:
** 342.299
+
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5395]]
+
* [[RXN-14789]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14788]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nigerose}}
+
{{#set: common-name=4-trans-undecenoyl-coa}}
{{#set: inchi-key=inchikey=qigjyvcqydkydw-nsyytrpssa-n}}
+
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}}
{{#set: molecular-weight=342.299}}
+
{{#set: molecular-weight=929.765}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-15677

  • common-name:
    • 4-trans-undecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • afmmiiqkxqnedn-dupkwvsksa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality