Difference between revisions of "SJ16496"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUKOTRIENE-C4 LEUKOTRIENE-C4] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] ==
 * common-name:
-** leukotriene-c4
+** an aldose
-* smiles:
-** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
-* inchi-key:
-** gwnvdxqdilpjig-nxolixfesa-l
-* molecular-weight:
-** 623.76
 == Reaction(s) known to consume the compound ==
-* [[RXN66-336]]
+* [[ALDEHYDE-REDUCTASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
+* [[ALDEHYDE-REDUCTASE-RXN]]
+* [[RXN-9926]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=leukotriene-c4}}
+{{#set: common-name=an aldose}}
-{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
-{{#set: molecular-weight=623.76}}