Difference between revisions of "SJ16502"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] == * common-name: ** l-2-amino-3-oxobutanoate * smiles: ** cc(=o)c([...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * common-name: ** nitrobenzene * smiles: ** c1(=cc=c(c=c1)[n+]([o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == |
* common-name: | * common-name: | ||
− | ** | + | ** nitrobenzene |
* smiles: | * smiles: | ||
− | ** cc(= | + | ** c1(=cc=c(c=c1)[n+]([o-])=o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lqnuzadurlcdlv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 123.111 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-3661]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=nitrobenzene}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqnuzadurlcdlv-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=123.111}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite BENZENE-NO2
- common-name:
- nitrobenzene
- smiles:
- c1(=cc=c(c=c1)[n+]([o-])=o)
- inchi-key:
- lqnuzadurlcdlv-uhfffaoysa-n
- molecular-weight:
- 123.111