Difference between revisions of "SJ16536"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * common-name: ** d-erythrose 4-phosphate * smiles: ** [ch](c(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9857 CPD-9857] == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9857 CPD-9857] ==
 
* common-name:
 
* common-name:
** d-erythrose 4-phosphate
+
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
 
* smiles:
 
* smiles:
** [ch](c(c(cop([o-])([o-])=o)o)o)=o
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** nghmdnpxvrffgs-iuyqgcfvsa-l
+
** ywvpprxiddchcq-cuhbluqcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 198.069
+
** 600.966
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2TRANSKETO-RXN]]
 
* [[DAHPSYN-RXN]]
 
* [[SEDOBISALDOL-RXN]]
 
* [[TRANSALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2TRANSKETO-RXN]]
+
* [[RXN-9225]]
* [[DAHPSYN-RXN]]
 
* [[SEDOBISALDOL-RXN]]
 
* [[TRANSALDOL-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-erythrose 4-phosphate}}
+
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
{{#set: inchi-key=inchikey=nghmdnpxvrffgs-iuyqgcfvsa-l}}
+
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
{{#set: molecular-weight=198.069}}
+
{{#set: molecular-weight=600.966}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-9857

  • common-name:
    • 2-methoxy-6-(all-trans-heptaprenyl)phenol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
  • inchi-key:
    • ywvpprxiddchcq-cuhbluqcsa-n
  • molecular-weight:
    • 600.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality