Difference between revisions of "SJ16536"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9857 CPD-9857] == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl5-N-acetyl-glucosamine2-R Mannosyl5-N-acetyl-glucosamine2-R] == * common-name: ** man5g...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9857 CPD-9857] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl5-N-acetyl-glucosamine2-R Mannosyl5-N-acetyl-glucosamine2-R] ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-heptaprenyl)phenol
+
** man5glcnac3-[protein]
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
 
* inchi-key:
 
** ywvpprxiddchcq-cuhbluqcsa-n
 
* molecular-weight:
 
** 600.966
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9225]]
+
* [[2.4.1.101-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}}
+
{{#set: common-name=man5glcnac3-[protein]}}
{{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}}
 
{{#set: molecular-weight=600.966}}
 

Revision as of 09:24, 27 August 2019

Metabolite Mannosyl5-N-acetyl-glucosamine2-R

  • common-name:
    • man5glcnac3-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "man5glcnac3-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.