Difference between revisions of "SJ16589"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Red-Disulfides Protein-Red-Disulfides] == * common-name: ** a protein with reduced sulf...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Red-Disulfides Protein-Red-Disulfides] ==
 
* common-name:
 
* common-name:
** (indol-3-yl)acetamide
+
** a protein with reduced sulfide groups
* smiles:
 
** c(n)(=o)cc1(=cnc2(c=cc=cc1=2))
 
* inchi-key:
 
** zoambxdogprzlp-uhfffaoysa-n
 
* molecular-weight:
 
** 174.202
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNN-404]]
+
* [[DISULFOXRED-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
+
* [[DISULFOXRED-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(indol-3-yl)acetamide}}
+
{{#set: common-name=a protein with reduced sulfide groups}}
{{#set: inchi-key=inchikey=zoambxdogprzlp-uhfffaoysa-n}}
 
{{#set: molecular-weight=174.202}}
 

Revision as of 09:23, 27 August 2019

Metabolite Protein-Red-Disulfides

  • common-name:
    • a protein with reduced sulfide groups

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality