Difference between revisions of "SJ16599"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] == * common-name: ** udp-4-ami...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenine-58 tRNA-Adenine-58] == * common-name: ** an adenine58 in trna == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-4-AMINO-4-DEOXY-L-ARABINOSE UDP-4-AMINO-4-DEOXY-L-ARABINOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Adenine-58 tRNA-Adenine-58] ==
 
* common-name:
 
* common-name:
−
** udp-4-amino-4-deoxy-β-l-arabinopyranose
+
** an adenine58 in trna
−
* smiles:
 
−
** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
 
−
* inchi-key:
 
−
** gwbakybswhqnmq-iazovdbxsa-m
 
−
* molecular-weight:
 
−
** 534.286
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-1863]]
+
* [[RXN-12466]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-1863]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}}
+
{{#set: common-name=an adenine58 in trna}}
−
{{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}}
 
−
{{#set: molecular-weight=534.286}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-Adenine-58

  • common-name:
    • an adenine58 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ16599&oldid=14800"