Difference between revisions of "SJ16652"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18077 CPD-18077] == * common-name: ** glc3man9glcnac2-[protein] == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-[(6'-methylthio)hexyl]malate |
+ | * smiles: | ||
+ | ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** lqqzhlhcfscjcu-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 262.32 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-18202]] |
+ | * [[RXNQT-4174]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-18202]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-[(6'-methylthio)hexyl]malate}} |
+ | {{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=262.32}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPDQT-39
- common-name:
- 3-[(6'-methylthio)hexyl]malate
- smiles:
- csccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- lqqzhlhcfscjcu-uhfffaoysa-l
- molecular-weight:
- 262.32
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(6'-methylthio)hexyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.