Difference between revisions of "SJ16659"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPHENOXAZINE ISOPHENOXAZINE] == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TUM1-S-sulfanylcysteine TUM1-S-sulfanylcysteine] == * common-name: ** a [3-mercaptopyruvate sul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOPHENOXAZINE ISOPHENOXAZINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TUM1-S-sulfanylcysteine TUM1-S-sulfanylcysteine] ==
 
* common-name:
 
* common-name:
** isophenoxazine
+
** a [3-mercaptopyruvate sulfurtransferase]-s-sulfanyl-l-cysteine
* smiles:
 
** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
 
* inchi-key:
 
** rdjxpxhqenrcng-uhfffaoysa-n
 
* molecular-weight:
 
** 212.207
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16821]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[O-AMINOPHENOL-OXIDASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isophenoxazine}}
+
{{#set: common-name=a [3-mercaptopyruvate sulfurtransferase]-s-sulfanyl-l-cysteine}}
{{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}}
 
{{#set: molecular-weight=212.207}}
 

Revision as of 14:20, 26 August 2019

Metabolite TUM1-S-sulfanylcysteine

  • common-name:
    • a [3-mercaptopyruvate sulfurtransferase]-s-sulfanyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [3-mercaptopyruvate sulfurtransferase]-s-sulfanyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.