Difference between revisions of "SJ16762"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8093 CPD-8093] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-precursors tRNA-precursors] ==
 * common-name:
-** 1-linoleoyl-2-&alpha;-linolenoyl-phosphatidylcholine
+** a trna precursor
-* smiles:
-** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
-* inchi-key:
-** hzgavpneghqjid-unbchyimsa-n
-* molecular-weight:
-** 780.076
 == Reaction(s) known to consume the compound ==
-* [[RXN-8325]]
+* [[3.1.26.11-RXN]]
+* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-8324]]
-* [[RXN-8329]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-linoleoyl-2-&alpha;-linolenoyl-phosphatidylcholine}}
+{{#set: common-name=a trna precursor}}
-{{#set: inchi-key=inchikey=hzgavpneghqjid-unbchyimsa-n}}
-{{#set: molecular-weight=780.076}}