Difference between revisions of "SJ16762"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-precursors tRNA-precursors] == * common-name: ** a trna precursor == Reaction(s) known to...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == * common-name: ** all-tra...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-precursors tRNA-precursors] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] ==
 
* common-name:
 
* common-name:
** a trna precursor
+
** all-trans-hexaprenyl diphosphate
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 +
* inchi-key:
 +
** ngfsmhkftzrokj-mmszmyibsa-k
 +
* molecular-weight:
 +
** 583.66
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.26.11-RXN]]
+
* [[RXN-9003]]
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trna precursor}}
+
{{#set: common-name=all-trans-hexaprenyl diphosphate}}
 +
{{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}}
 +
{{#set: molecular-weight=583.66}}

Revision as of 09:25, 27 August 2019

Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-hexaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ngfsmhkftzrokj-mmszmyibsa-k
  • molecular-weight:
    • 583.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality