Difference between revisions of "SJ16883"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Galactopyranose L-Galactopyranose] == * common-name: ** l-galactopyranose == Reaction(s) know...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == |
* common-name: | * common-name: | ||
| − | ** l- | + | ** l-arogenate |
| + | * smiles: | ||
| + | ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o | ||
| + | * inchi-key: | ||
| + | ** mieildywganznh-dsquftabsa-m | ||
| + | * molecular-weight: | ||
| + | ** 226.208 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
| + | * [[PREPHENATE-TRANSAMINE-RXN]] | ||
| + | * [[RXN-5682]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PREPHENATE-ASP-TRANSAMINE-RXN]] |
| + | * [[PREPHENATE-TRANSAMINE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=l-arogenate}} |
| + | {{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}} | ||
| + | {{#set: molecular-weight=226.208}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-659
- common-name:
- l-arogenate
- smiles:
- c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
- inchi-key:
- mieildywganznh-dsquftabsa-m
- molecular-weight:
- 226.208
