Difference between revisions of "SJ16901"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * in...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-delta-3-decenoyl-ACPs Cis-delta-3-decenoyl-ACPs] == * common-name: ** a (3z)-dec-3-enoyl-[a...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-delta-3-decenoyl-ACPs Cis-delta-3-decenoyl-ACPs] == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (3z)-dec-3-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-2141]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3z)-dec-3-enoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 14:20, 26 August 2019
Contents
Metabolite Cis-delta-3-decenoyl-ACPs
- common-name:
- a (3z)-dec-3-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3z)-dec-3-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
