Difference between revisions of "SJ16902"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...")
 
(Created page with "Category:gene == Gene SJ16902 == * transcription-direction: ** positive * right-end-position: ** 143013 * left-end-position: ** 134429 * centisome-position: ** 48.76075...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] ==
+
== Gene SJ16902 ==
* common-name:
+
* transcription-direction:
** ubiquinol-8
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** 143013
* inchi-key:
+
* left-end-position:
** lojuqfspyhmheo-sghxuwjisa-n
+
** 134429
* molecular-weight:
+
* centisome-position:
** 729.137
+
** 48.76075   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[R00281]]
+
* [[S.japonica_carotenoid_curated]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.4.19.12-RXN]]
* [[DHHB-METHYLTRANSFER-RXN]]
+
** Category: [[annotation]]
* [[R00281]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[SUCDH_LPAREN_q8_RPAREN_m]]
+
{{#set: transcription-direction=positive}}
== Reaction(s) of unknown directionality ==
+
{{#set: right-end-position=143013}}
{{#set: common-name=ubiquinol-8}}
+
{{#set: left-end-position=134429}}
{{#set: inchi-key=inchikey=lojuqfspyhmheo-sghxuwjisa-n}}
+
{{#set: centisome-position=48.76075    }}
{{#set: molecular-weight=729.137}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ16902

  • transcription-direction:
    • positive
  • right-end-position:
    • 143013
  • left-end-position:
    • 134429
  • centisome-position:
    • 48.76075

Organism(s) associated with this gene

Reaction(s) associated