Difference between revisions of "SJ16902"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * common-name: ** ubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7015 CPD-7015] ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** ubiquinol-8
+
** 71-hydroxychlorophyllide a
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 
* inchi-key:
 
** lojuqfspyhmheo-sghxuwjisa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 729.137
+
** 628.966
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R00281]]
+
* [[RXN-7677]]
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DHHB-METHYLTRANSFER-RXN]]
+
* [[RXN-7676]]
* [[R00281]]
 
* [[SUCDH_LPAREN_q8_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ubiquinol-8}}
+
{{#set: common-name=71-hydroxychlorophyllide a}}
{{#set: inchi-key=inchikey=lojuqfspyhmheo-sghxuwjisa-n}}
+
{{#set: molecular-weight=628.966}}
{{#set: molecular-weight=729.137}}
 

Revision as of 14:19, 26 August 2019

Metabolite CPD-7015

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(co)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 71-hydroxychlorophyllide a
  • molecular-weight:
    • 628.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality