Difference between revisions of "SJ16913"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_III COPROPORPHYRINOGEN_III] == * common-name: ** coproporphyrinogen iii * sm...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-1-7-P2 D-SEDOHEPTULOSE-1-7-P2] == * common-name: ** d-sedoheptulose-1,7-bisphos...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_III COPROPORPHYRINOGEN_III] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-1-7-P2 D-SEDOHEPTULOSE-1-7-P2] ==
 
* common-name:
 
* common-name:
** coproporphyrinogen iii
+
** d-sedoheptulose-1,7-bisphosphate
 
* smiles:
 
* smiles:
** cc1(=c2(cc5(=c(c)c(ccc([o-])=o)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc(=o)[o-])c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
+
** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** niuvhxtxuxofeb-uhfffaoysa-j
+
** okhxougreccasi-shuuezrqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 656.734
+
** 366.112
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEMN-RXN]]
+
* [[SEDOBISALDOL-RXN]]
* [[RXN-17517]]
+
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
* [[RXN0-1461]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UROGENDECARBOX-RXN]]
+
* [[SEDOBISALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen iii}}
+
{{#set: common-name=d-sedoheptulose-1,7-bisphosphate}}
{{#set: inchi-key=inchikey=niuvhxtxuxofeb-uhfffaoysa-j}}
+
{{#set: inchi-key=inchikey=okhxougreccasi-shuuezrqsa-j}}
{{#set: molecular-weight=656.734}}
+
{{#set: molecular-weight=366.112}}

Revision as of 14:20, 26 August 2019

Metabolite D-SEDOHEPTULOSE-1-7-P2

  • common-name:
    • d-sedoheptulose-1,7-bisphosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
  • inchi-key:
    • okhxougreccasi-shuuezrqsa-j
  • molecular-weight:
    • 366.112

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality