Difference between revisions of "SJ16948"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * common-name: ** β-l-arabinose 1-phosphate * smiles: ** c1(oc(c(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Keratan-sulfate-NAcGlcN6S Keratan-sulfate-NAcGlcN6S] == * common-name: ** [keratan sulfate]-&al...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Keratan-sulfate-NAcGlcN6S Keratan-sulfate-NAcGlcN6S] ==
 
* common-name:
 
* common-name:
** β-l-arabinose 1-phosphate
+
** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
* smiles:
 
** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-])
 
* inchi-key:
 
** ilxhfxfppzgenn-qmkxcqhvsa-l
 
* molecular-weight:
 
** 228.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UMPU]]
+
* [[RXN-11570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-l-arabinose 1-phosphate}}
+
{{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}}
{{#set: inchi-key=inchikey=ilxhfxfppzgenn-qmkxcqhvsa-l}}
 
{{#set: molecular-weight=228.095}}
 

Revision as of 14:19, 26 August 2019

Metabolite Keratan-sulfate-NAcGlcN6S

  • common-name:
    • [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.