Difference between revisions of "SJ16951"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP] == * common-na...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] ==
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
+
** 3-methoxy-4-hydroxyphenylglycol
 
* smiles:
 
* smiles:
** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
+
** coc1(=c(o)c=cc(c(o)co)=c1)
 
* inchi-key:
 
* inchi-key:
** agqjqcfepuvxnk-uhfffaoysa-k
+
** fbwpwwwzwkpjfl-qmmmgpobsa-n
 
* molecular-weight:
 
* molecular-weight:
** 296.093
+
** 184.191
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12610]]
+
* [[RXN-10915]]
* [[RXN-12611]]
 
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRIMSYN3-RXN]]
+
* [[RXN-10915]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}}
+
{{#set: common-name=3-methoxy-4-hydroxyphenylglycol}}
{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=fbwpwwwzwkpjfl-qmmmgpobsa-n}}
{{#set: molecular-weight=296.093}}
+
{{#set: molecular-weight=184.191}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-11497

  • common-name:
    • 3-methoxy-4-hydroxyphenylglycol
  • smiles:
    • coc1(=c(o)c=cc(c(o)co)=c1)
  • inchi-key:
    • fbwpwwwzwkpjfl-qmmmgpobsa-n
  • molecular-weight:
    • 184.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality