Difference between revisions of "SJ16954"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c...")
(Created page with "Category:gene == Gene SJ16954 == * transcription-direction: ** negative * right-end-position: ** 567151 * left-end-position: ** 555123 * centisome-position: ** 81.39598...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
+
== Gene SJ16954 ==
* common-name:
+
* transcription-direction:
** serotonin o-sulfate
+
** negative
* smiles:
+
* right-end-position:
** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
+
** 567151
* inchi-key:
+
* left-end-position:
** jfwysggscoobgk-uhfffaoysa-n
+
** 555123
* molecular-weight:
+
* centisome-position:
** 256.276
+
** 81.39598   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-10777]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
{{#set: common-name=serotonin o-sulfate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=256.276}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=567151}}
 +
{{#set: left-end-position=555123}}
 +
{{#set: centisome-position=81.39598    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ16954

  • transcription-direction:
    • negative
  • right-end-position:
    • 567151
  • left-end-position:
    • 555123
  • centisome-position:
    • 81.39598

Organism(s) associated with this gene

Reaction(s) associated