Difference between revisions of "SJ16954"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c...")
(Created page with "Category:gene == Gene SJ04970 == * transcription-direction: ** negative * right-end-position: ** 442527 * left-end-position: ** 425133 * centisome-position: ** 44.02631...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
+
== Gene SJ04970 ==
* common-name:
+
* transcription-direction:
** serotonin o-sulfate
+
** negative
* smiles:
+
* right-end-position:
** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
+
** 442527
* inchi-key:
+
* left-end-position:
** jfwysggscoobgk-uhfffaoysa-n
+
** 425133
* molecular-weight:
+
* centisome-position:
** 256.276
+
** 44.02631   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
* [[RXN-10777]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[2.4.1.223-RXN]]
{{#set: common-name=serotonin o-sulfate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=256.276}}
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6558]]
 +
** '''7''' reactions found over '''13''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=442527}}
 +
{{#set: left-end-position=425133}}
 +
{{#set: centisome-position=44.02631    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ04970

  • transcription-direction:
    • negative
  • right-end-position:
    • 442527
  • left-end-position:
    • 425133
  • centisome-position:
    • 44.02631

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6558
    • 7 reactions found over 13 reactions in the full pathway