Difference between revisions of "SJ17004"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-D2-ENOYL-ACP TRANS-D2-ENOYL-ACP] == * common-name: ** a trans-2-enoyl-[acyl-carrier prote...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-D2-ENOYL-ACP TRANS-D2-ENOYL-ACP] ==
 
* common-name:
 
* common-name:
** indole-3-glycol
+
** a trans-2-enoyl-[acyl-carrier protein]
* smiles:
 
** c2(=c(c1(c=cc=cc=1n2))c(o)co)
 
* inchi-key:
 
** xnjdzrgywqbbmz-uhfffaoysa-n
 
* molecular-weight:
 
** 177.202
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.3.1.9-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5424]]
+
* [[1.3.1.9-RXN]]
 +
* [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indole-3-glycol}}
+
{{#set: common-name=a trans-2-enoyl-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}}
 
{{#set: molecular-weight=177.202}}
 

Revision as of 09:24, 27 August 2019

Metabolite TRANS-D2-ENOYL-ACP

  • common-name:
    • a trans-2-enoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-2-enoyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.