Difference between revisions of "SJ17014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARGININO-SUCCINATE L-ARGININO-SUCCINATE] == * common-name: ** l-arginino-succinate * smiles:...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-lysine Histone-L-lysine] == * common-name: ** a [histone]-l-lysine == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARGININO-SUCCINATE L-ARGININO-SUCCINATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-lysine Histone-L-lysine] ==
 
* common-name:
 
* common-name:
** l-arginino-succinate
+
** a [histone]-l-lysine
* smiles:
 
** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+]
 
* inchi-key:
 
** kdzoasgqnopscu-zbhicjrosa-m
 
* molecular-weight:
 
** 289.267
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARGSUCCINLYA-RXN]]
+
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 +
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGSUCCINLYA-RXN]]
+
* [[3.5.1.98-RXN]]
* [[ARGSUCCINSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arginino-succinate}}
+
{{#set: common-name=a [histone]-l-lysine}}
{{#set: inchi-key=inchikey=kdzoasgqnopscu-zbhicjrosa-m}}
 
{{#set: molecular-weight=289.267}}
 

Revision as of 14:20, 26 August 2019

Metabolite Histone-L-lysine

  • common-name:
    • a [histone]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [histone]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.