Difference between revisions of "SJ17016"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYL-GLYOXAL METHYL-GLYOXAL] == * common-name: ** methylglyoxal * smiles: ** cc([ch]=o)=o * i...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYL-GLYOXAL METHYL-GLYOXAL] ==
 
* common-name:
 
* common-name:
** paraoxon
+
** methylglyoxal
 
* smiles:
 
* smiles:
** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
+
** cc([ch]=o)=o
 
* inchi-key:
 
* inchi-key:
** wymsbxtxohuigt-uhfffaoysa-n
+
** aijulsrzwuxgpq-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 275.197
+
** 72.063
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8746]]
+
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXIII-RXN]]
 +
* [[RXN-17627]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[RXN-17627]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=paraoxon}}
+
{{#set: common-name=methylglyoxal}}
{{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=aijulsrzwuxgpq-uhfffaoysa-n}}
{{#set: molecular-weight=275.197}}
+
{{#set: molecular-weight=72.063}}

Revision as of 14:20, 26 August 2019

Metabolite METHYL-GLYOXAL

  • common-name:
    • methylglyoxal
  • smiles:
    • cc([ch]=o)=o
  • inchi-key:
    • aijulsrzwuxgpq-uhfffaoysa-n
  • molecular-weight:
    • 72.063

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality