Difference between revisions of "SJ17064"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19339 CPD-19339] == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-c Cytochromes-c] == * common-name: ** a c-type cytochrome == Reaction(s) known to c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19339 CPD-19339] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-c Cytochromes-c] ==
 
* common-name:
 
* common-name:
** α-d-sedoheptulopyranose 7-phosphate
+
** a c-type cytochrome
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1)
 
* inchi-key:
 
** cbidvwsruuodhl-ovhbtucosa-l
 
* molecular-weight:
 
** 288.147
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9140]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-sedoheptulopyranose 7-phosphate}}
+
{{#set: common-name=a c-type cytochrome}}
{{#set: inchi-key=inchikey=cbidvwsruuodhl-ovhbtucosa-l}}
 
{{#set: molecular-weight=288.147}}
 

Revision as of 14:20, 26 August 2019

Metabolite Cytochromes-c

  • common-name:
    • a c-type cytochrome

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality