Difference between revisions of "SJ17240"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-6-P-GLUCONATE 2-KETO-3-DEOXY-6-P-GLUCONATE] == * common-name: ** 2-dehydro-3-deo...")
(Created page with "Category:gene == Gene SJ17240 == * transcription-direction: ** negative * right-end-position: ** 502650 * left-end-position: ** 459479 * centisome-position: ** 67.837204...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-6-P-GLUCONATE 2-KETO-3-DEOXY-6-P-GLUCONATE] ==
+
== Gene SJ17240 ==
−
* common-name:
+
* transcription-direction:
−
** 2-dehydro-3-deoxy-d-gluconate 6-phosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
+
** 502650
−
* inchi-key:
+
* left-end-position:
−
** ovprppovaxrced-wvzvxsggsa-k
+
** 459479
−
* molecular-weight:
+
* centisome-position:
−
** 255.098
+
** 67.837204   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[KDPGALDOL-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[PGLUCONDEHYDRAT-RXN]]
+
* [[2.7.12.1-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}}
+
* [[PROTEIN-KINASE-RXN]]
−
{{#set: molecular-weight=255.098}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=502650}}
 +
{{#set: left-end-position=459479}}
 +
{{#set: centisome-position=67.837204    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:01, 18 March 2021

Gene SJ17240

  • transcription-direction:
    • negative
  • right-end-position:
    • 502650
  • left-end-position:
    • 459479
  • centisome-position:
    • 67.837204

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ17240&oldid=131866"