Difference between revisions of "SJ17253"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-763 CPD-763] ==
 * common-name:
-** (2e)-dodec-2-enoyl-coa
+** arsenite
 * smiles:
-** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
+** [as](o)([o-])o
 * inchi-key:
-** irfyvbulxzmede-xcfippspsa-j
+** aqlmhyswfmlwbs-uhfffaoysa-n
 * molecular-weight:
-** 943.792
+** 124.936
 == Reaction(s) known to consume the compound ==
-* [[ECOAH5]]
+* [[2.1.1.137-RXN]]
-* [[ECOAH5h]]
+* [[3.6.3.16-RXN]]
-* [[ECOAH5m]]
-* [[RXN-14262]]
-* [[RXN-7931]]
 == Reaction(s) known to produce the compound ==
-* [[ACOA120OR]]
+* [[3.6.3.16-RXN]]
-* [[ECOAH5]]
+* [[RXN-982]]
-* [[ECOAH5h]]
-* [[ECOAH5m]]
-* [[RXN-14262]]
-* [[RXN-7931]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
+{{#set: common-name=arsenite}}
-{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
+{{#set: inchi-key=inchikey=aqlmhyswfmlwbs-uhfffaoysa-n}}
-{{#set: molecular-weight=943.792}}
+{{#set: molecular-weight=124.936}}