Difference between revisions of "SJ17253"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-763 CPD-763] == * common-name: ** arsenite * smiles: ** [as](o)([o-])o * inchi-key: ** aqlm...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == |
* common-name: | * common-name: | ||
| − | ** | + | ** edta |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kcxvzyzypllwcc-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 290.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-EDTA]] |
| − | * [[ | + | * [[TransportSeed-EDTA]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-EDTA]] |
| − | * [[ | + | * [[TransportSeed-EDTA]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=edta}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kcxvzyzypllwcc-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=290.229}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite EDTA
- common-name:
- edta
- smiles:
- c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o
- inchi-key:
- kcxvzyzypllwcc-uhfffaoysa-l
- molecular-weight:
- 290.229
