Difference between revisions of "SJ17283"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-hydroxyacyl-glutathiones 2-hydroxyacyl-glutathiones] == * common-name: ** s-(2-hydroxyacyl)gl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3486 CPD-3486] == * common-name: ** 3-chlorobenzoate * smiles: ** c1(c=c(cl)c=c(c=1)c(=o)[o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3486 CPD-3486] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-chlorobenzoate |
| + | * smiles: | ||
| + | ** c1(c=c(cl)c=c(c=1)c(=o)[o-]) | ||
| + | * inchi-key: | ||
| + | ** lulayugmbfyyex-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 155.56 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9910]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-chlorobenzoate}} |
| + | {{#set: inchi-key=inchikey=lulayugmbfyyex-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=155.56}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-3486
- common-name:
- 3-chlorobenzoate
- smiles:
- c1(c=c(cl)c=c(c=1)c(=o)[o-])
- inchi-key:
- lulayugmbfyyex-uhfffaoysa-m
- molecular-weight:
- 155.56
