Difference between revisions of "SJ17301"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRITE NITRITE] == * common-name: ** nitrite * smiles: ** n([o-])=o * inchi-key: ** iovcwxunbo...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-321 CPD-321] == * common-name: ** 3-aci-nitropropanoate * smiles: ** c(cc([o-])=o)=[n+]([o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-321 CPD-321] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-aci-nitropropanoate |
* smiles: | * smiles: | ||
| − | ** n([o-]) | + | ** c(cc([o-])=o)=[n+]([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kxxxivrxvxkxpa-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 117.061 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16322]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-aci-nitropropanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kxxxivrxvxkxpa-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=117.061}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-321
- common-name:
- 3-aci-nitropropanoate
- smiles:
- c(cc([o-])=o)=[n+]([o-])[o-]
- inchi-key:
- kxxxivrxvxkxpa-uhfffaoysa-m
- molecular-weight:
- 117.061
