Difference between revisions of "SJ17329"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=yW-72 yW-72] == * common-name: ** 7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Re...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)scc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-cis-undecenoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** afmmiiqkxqnedn-nsdzghcesa-j | ||
| + | * molecular-weight: | ||
| + | ** 929.765 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14775]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14774]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-cis-undecenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}} | ||
| + | {{#set: molecular-weight=929.765}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-15668
- common-name:
- 4-cis-undecenoyl-coa
- smiles:
- ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- afmmiiqkxqnedn-nsdzghcesa-j
- molecular-weight:
- 929.765
