Difference between revisions of "SJ17372"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ASN-tRNAs Charged-ASN-tRNAs] == * common-name: ** an l-asparaginyl-[trnaasn] == Reactio...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * sm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ASN-tRNAs Charged-ASN-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
 
* common-name:
 
* common-name:
** an l-asparaginyl-[trnaasn]
+
** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
 +
* smiles:
 +
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
 +
* inchi-key:
 +
** vxmxkdahjurhen-sdbhatresa-k
 +
* molecular-weight:
 +
** 492.298
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12460]]
+
* [[RXN-4311]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.3.5.6-RXN]]
+
* [[RXN-4305]]
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
+
* [[RXN-4311]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-asparaginyl-[trnaasn]}}
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}}
 +
{{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}}
 +
{{#set: molecular-weight=492.298}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-4203

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • vxmxkdahjurhen-sdbhatresa-k
  • molecular-weight:
    • 492.298

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality