Difference between revisions of "SJ17379"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * common-name: ** 1,5-anhydro-d-mannitol * smiles: ** c(o)c1(occ(o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] ==
 
* common-name:
 
* common-name:
** 1,5-anhydro-d-mannitol
+
** d-myo-inositol (1,3,4,6)-tetrakisphosphate
 
* smiles:
 
* smiles:
** c(o)c1(occ(o)c(o)c(o)1)
+
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
* inchi-key:
** mpcajmnynogxpb-kvtdhhqdsa-n
+
** zawixngttztbkv-jmvowjsssa-f
 
* molecular-weight:
 
* molecular-weight:
** 164.158
+
** 492.013
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13064]]
+
* [[2.7.1.140-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.1.133-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,5-anhydro-d-mannitol}}
+
{{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}}
{{#set: inchi-key=inchikey=mpcajmnynogxpb-kvtdhhqdsa-n}}
+
{{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}}
{{#set: molecular-weight=164.158}}
+
{{#set: molecular-weight=492.013}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-505

  • common-name:
    • d-myo-inositol (1,3,4,6)-tetrakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • zawixngttztbkv-jmvowjsssa-f
  • molecular-weight:
    • 492.013

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality