Difference between revisions of "SJ17379"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] == * common-name: ** d-myo-inositol (1,3,4,6)-tetrakisphosphate * smiles: ** c...")
(Created page with "Category:gene == Gene SJ12321 == * transcription-direction: ** negative * right-end-position: ** 286351 * left-end-position: ** 273813 * centisome-position: ** 76.04776...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-505 CPD-505] ==
+
== Gene SJ12321 ==
−
* common-name:
+
* transcription-direction:
−
** d-myo-inositol (1,3,4,6)-tetrakisphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** 286351
−
* inchi-key:
+
* left-end-position:
−
** zawixngttztbkv-jmvowjsssa-f
+
** 273813
−
* molecular-weight:
+
* centisome-position:
−
** 492.013
+
** 76.04776   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[2.7.1.140-RXN]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[2.7.1.133-RXN]]
+
* [[RXN-6883]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=d-myo-inositol (1,3,4,6)-tetrakisphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=zawixngttztbkv-jmvowjsssa-f}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=492.013}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-4302]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=286351}}
 +
{{#set: left-end-position=273813}}
 +
{{#set: centisome-position=76.04776    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ12321

  • transcription-direction:
    • negative
  • right-end-position:
    • 286351
  • left-end-position:
    • 273813
  • centisome-position:
    • 76.04776

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-4302
    • 3 reactions found over 3 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ17379&oldid=41066"