Difference between revisions of "SJ17481"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-6-P-GLUCONO-DELTA-LACTONE D-6-P-GLUCONO-DELTA-LACTONE] == * common-name: ** 6-phospho d-gluco...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-6-P-GLUCONO-DELTA-LACTONE D-6-P-GLUCONO-DELTA-LACTONE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-phospho d-glucono-1,5-lactone |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ijojivndfqsgab-sqougzdysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[6PGLUCONOLACT-RXN]] |
| − | * [[ | + | * [[RXN-14819]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[G6PADH]] |
| − | + | * [[G6PADHh]] | |
| − | + | * [[G6PBDH]] | |
| − | + | * [[G6PBDHh]] | |
| − | + | * [[GLU6PDEHYDROG-RXN]] | |
| − | + | * [[RXN-14819]] | |
| − | |||
| − | |||
| − | * [[ | ||
| − | * [[ | ||
| − | * [[ | ||
| − | * [[ | ||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-phospho d-glucono-1,5-lactone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.105}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite D-6-P-GLUCONO-DELTA-LACTONE
- common-name:
- 6-phospho d-glucono-1,5-lactone
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
- inchi-key:
- ijojivndfqsgab-sqougzdysa-l
- molecular-weight:
- 256.105
