Difference between revisions of "SJ17481"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(o...")
 
(Created page with "Category:gene == Gene SJ17481 == * transcription-direction: ** negative * right-end-position: ** 23718 * left-end-position: ** 8447 * centisome-position: ** 3.2271497...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] ==
+
== Gene SJ17481 ==
* common-name:
+
* transcription-direction:
** α-d-glucopyranose 1-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** 23718
* inchi-key:
+
* left-end-position:
** hxxfsfrbohsimq-vfuothlcsa-l
+
** 8447
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 3.2271497   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
== Reaction(s) associated ==
* [[PGCM]]
+
* [[RXN-1302]]
* [[PGMTh]]
+
** Category: [[orthology]]
* [[PHOSPHOGLUCMUT-RXN]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[RXN-12486]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-16997]]
+
* [[TAGAALDOL-RXN]]
* [[RXN4FS-13]]
+
** Category: [[annotation]]
* [[UG1PUT]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[PWY-481]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
* [[GLYCOPHOSPHORYL-RXN]]
+
* [[GALACTITOLCAT-PWY]]
* [[GLYMALTOPHOSPHORYL-RXN]]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
* [[PGCM]]
+
* [[PWY-7395]]
* [[PGMTh]]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
* [[PHOSPHOGLUCMUT-RXN]]
+
* [[PWY-7077]]
* [[RXN-12171]]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
* [[RXN-12392]]
+
* [[LACTOSECAT-PWY]]
* [[RXN-12486]]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
* [[RXN-14284]]
+
{{#set: transcription-direction=negative}}
* [[RXN-14285]]
+
{{#set: right-end-position=23718}}
* [[RXN-14286]]
+
{{#set: left-end-position=8447}}
* [[RXN-14353]]
+
{{#set: centisome-position=3.2271497    }}
* [[RXN-1826]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-9025]]
+
{{#set: nb reaction associated=2}}
* [[RXN0-5182]]
+
{{#set: nb pathway associated=5}}
* [[RXN0-5184]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
 
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ17481

  • transcription-direction:
    • negative
  • right-end-position:
    • 23718
  • left-end-position:
    • 8447
  • centisome-position:
    • 3.2271497

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-481
    • 2 reactions found over 5 reactions in the full pathway
  • GALACTITOLCAT-PWY
    • 2 reactions found over 5 reactions in the full pathway
  • PWY-7395
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-7077
    • 2 reactions found over 5 reactions in the full pathway
  • LACTOSECAT-PWY
    • 2 reactions found over 4 reactions in the full pathway