Difference between revisions of "SJ17481"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-6-P-GLUCONO-DELTA-LACTONE D-6-P-GLUCONO-DELTA-LACTONE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRITE NITRITE] ==
 * common-name:
-** 6-phospho d-glucono-1,5-lactone
+** nitrite
 * smiles:
-** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
+** n([o-])=o
 * inchi-key:
-** ijojivndfqsgab-sqougzdysa-l
+** iovcwxunbopuch-uhfffaoysa-m
 * molecular-weight:
-** 256.105
+** 46.005
 == Reaction(s) known to consume the compound ==
-* [[6PGLUCONOLACT-RXN]]
+* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
-* [[RXN-14819]]
+* [[NITRATREDUCT-RXN]]
+* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
+* [[RXN-15838]]
+* [[RXN0-6377]]
+* [[TRANS-RXN-137]]
 == Reaction(s) known to produce the compound ==
-* [[G6PADH]]
+* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
-* [[G6PADHh]]
+* [[NITRATE-REDUCTASE-NADH-RXN]]
-* [[G6PBDH]]
+* [[NITRATE-REDUCTASE-NADPH-RXN]]
-* [[G6PBDHh]]
+* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
-* [[GLU6PDEHYDROG-RXN]]
+* [[NITRATREDUCT-RXN]]
-* [[RXN-14819]]
+* [[RXN-15838]]
+* [[RXN-16322]]
+* [[RXN-3661]]
+* [[TRANS-RXN-137]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
+{{#set: common-name=nitrite}}
-{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
+{{#set: inchi-key=inchikey=iovcwxunbopuch-uhfffaoysa-m}}
-{{#set: molecular-weight=256.105}}
+{{#set: molecular-weight=46.005}}